C39H57N9 — CID 176842958
2-[3,5-bis(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-4,6-ditert-butyl-1,3,5-triazine (PubChem CID 176842958) has the molecular formula C39H57N9 and a molecular weight of 651.95 g/mol. Its IUPAC name is 2-[3,5-bis(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-4,6-ditert-butyl-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-4,6-ditert-butyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176842958 |
| Molecular Formula | C39H57N9 |
| Molecular Weight | 651.95 g/mol |
| Exact Mass | 651.47 |
| IUPAC Name | 2-[3,5-bis(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-4,6-ditert-butyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2cc(-c3nc(C(C)(C)C)nc(C(C)(C)C)n3)cc(-c3nc(C(C)(C)C)nc(C(C)(C)C)n3)c2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C39H57N9/c1-34(2,3)28-40-25(41-29(46-28)35(4,5)6)22-19-23(26-42-30(36(7,8)9)47-31(43-26)37(10,11)12)21-24(20-22)27-44-32(38(13,14)15)48-33(45-27)39(16,17)18/h19-21H,1-18H3 |
| InChIKey | VZOLDTWPSZBWHK-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.95 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |