C36H48N6 — CID 102108600
2,4-ditert-butyl-6-[4-[2-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-1,3,5-triazine (PubChem CID 102108600) has the molecular formula C36H48N6 and a molecular weight of 564.82 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[2-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[4-[2-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 102108600 |
| Molecular Formula | C36H48N6 |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[2-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(CCc3ccc(-c4nc(C(C)(C)C)nc(C(C)(C)C)n4)cc3)cc2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C36H48N6/c1-33(2,3)29-37-27(38-30(41-29)34(4,5)6)25-19-15-23(16-20-25)13-14-24-17-21-26(22-18-24)28-39-31(35(7,8)9)42-32(40-28)36(10,11)12/h15-22H,13-14H2,1-12H3 |
| InChIKey | LOHNJPUCTUUYOO-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |