C45H54N9OP — CID 176843104
2-tert-butyl-4-[3-[4-tert-butyl-6-[3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-6-(4-dimethylphosphorylphenyl)-1,3,5-triazine (PubChem CID 176843104) has the molecular formula C45H54N9OP and a molecular weight of 767.96 g/mol. Its IUPAC name is 2-tert-butyl-4-[3-[4-tert-butyl-6-[3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-6-(4-dimethylphosphorylphenyl)-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-[3-[4-tert-butyl-6-[3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-6-(4-dimethylphosphorylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176843104 |
| Molecular Formula | C45H54N9OP |
| Molecular Weight | 767.96 g/mol |
| Exact Mass | 767.42 |
| IUPAC Name | 2-tert-butyl-4-[3-[4-tert-butyl-6-[3-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-6-(4-dimethylphosphorylphenyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(P(C)(C)=O)cc2)nc(-c2cccc(-c3nc(-c4cccc(-c5nc(C(C)(C)C)nc(C(C)(C)C)n5)c4)nc(C(C)(C)C)n3)c2)n1 |
| InChI | InChI=1S/C45H54N9OP/c1-42(2,3)38-48-33(27-21-23-32(24-22-27)56(13,14)55)46-34(49-38)28-17-15-18-29(25-28)35-47-36(51-39(50-35)43(4,5)6)30-19-16-20-31(26-30)37-52-40(44(7,8)9)54-41(53-37)45(10,11)12/h15-26H,1-14H3 |
| InChIKey | NIMPLRQKZSKMKK-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 133.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.96 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|