C66H41BCl2N6O5 — CID 159291210
dibenzofuran-2-ylboronic acid;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;2,4-di(dibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 159291210) has the molecular formula C66H41BCl2N6O5 and a molecular weight of 1079.81 g/mol. Its IUPAC name is dibenzofuran-2-ylboronic acid;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;2,4-di(dibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | dibenzofuran-2-ylboronic acid;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;2,4-di(dibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 159291210 |
| Molecular Formula | C66H41BCl2N6O5 |
| Molecular Weight | 1079.81 g/mol |
| Exact Mass | 1078.26 |
| IUPAC Name | dibenzofuran-2-ylboronic acid;2,4-dichloro-6-(3-phenylphenyl)-1,3,5-triazine;2,4-di(dibenzofuran-2-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Clc1nc(Cl)nc(-c2cccc(-c3ccccc3)c2)n1.OB(O)c1ccc2oc3ccccc3c2c1.c1ccc(-c2cccc(-c3nc(-c4ccc5oc6ccccc6c5c4)nc(-c4ccc5oc6ccccc6c5c4)n3)c2)cc1 |
| InChI | InChI=1S/C39H23N3O2.C15H9Cl2N3.C12H9BO3/c1-2-9-24(10-3-1)25-11-8-12-26(21-25)37-40-38(27-17-19-35-31(22-27)29-13-4-6-15-33(29)43-35)42-39(41-37)28-18-20-36-32(23-28)30-14-5-7-16-34(30)44-36;16-14-18-13(19-15(17)20-14)12-8-4-7-11(9-12)10-5-2-1-3-6-10;14-13(15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-23H;1-9H;1-7,14-15H |
| InChIKey | LADLLRQOMUBMLB-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.81 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|