C28H22BN3O2 — CID 156771953
[4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,3,5-triazin-2-yl]boronic acid (PubChem CID 156771953) has the molecular formula C28H22BN3O2 and a molecular weight of 443.32 g/mol. Its IUPAC name is [4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,3,5-triazin-2-yl]boronic acid.
| Compound Name | [4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,3,5-triazin-2-yl]boronic acid |
|---|---|
| PubChem CID | 156771953 |
| Molecular Formula | C28H22BN3O2 |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,3,5-triazin-2-yl]boronic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(B(O)O)nc(-c4ccc5ccccc5c4)n3)cc21 |
| InChI | InChI=1S/C28H22BN3O2/c1-28(2)23-10-6-5-9-21(23)22-14-13-20(16-24(22)28)26-30-25(31-27(32-26)29(33)34)19-12-11-17-7-3-4-8-18(17)15-19/h3-16,33-34H,1-2H3 |
| InChIKey | DKTNVIKBPYTKTM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|