C35H29BN2O2 — CID 123245503
3-isocyano-9-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbazole (PubChem CID 123245503) has the molecular formula C35H29BN2O2 and a molecular weight of 520.44 g/mol. Its IUPAC name is 3-isocyano-9-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbazole.
| Compound Name | 3-isocyano-9-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbazole |
|---|---|
| PubChem CID | 123245503 |
| Molecular Formula | C35H29BN2O2 |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 3-isocyano-9-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccc(B4OC(C)(C)C(C)(C)O4)c4ccccc34)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C35H29BN2O2/c1-34(2)35(3,4)40-36(39-34)31-18-17-26(27-13-9-10-14-28(27)31)23-15-19-32-29(21-23)30-22-24(37-5)16-20-33(30)38(32)25-11-7-6-8-12-25/h6-22H,1-4H3 |
| InChIKey | DKNIKGQXHYDSAI-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 27.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|