C54H31N5 — CID 140795168
18-[4-(6-isocyano-9-phenylcarbazol-3-yl)naphthalen-1-yl]-22-phenyl-6,9,21-triazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15(20),16,18,21-undecaene (PubChem CID 140795168) has the molecular formula C54H31N5 and a molecular weight of 749.88 g/mol. Its IUPAC name is 18-[4-(6-isocyano-9-phenylcarbazol-3-yl)naphthalen-1-yl]-22-phenyl-6,9,21-triazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15(20),16,18,21-undecaene.
| Compound Name | 18-[4-(6-isocyano-9-phenylcarbazol-3-yl)naphthalen-1-yl]-22-phenyl-6,9,21-triazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15(20),16,18,21-undecaene |
|---|---|
| PubChem CID | 140795168 |
| Molecular Formula | C54H31N5 |
| Molecular Weight | 749.88 g/mol |
| Exact Mass | 749.26 |
| IUPAC Name | 18-[4-(6-isocyano-9-phenylcarbazol-3-yl)naphthalen-1-yl]-22-phenyl-6,9,21-triazapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,5,7,9,11,13,15(20),16,18,21-undecaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccc(-c4ccc5c(c4)nc(-c4ccccc4)c4c6cccnc6c6ncccc6c54)c4ccccc34)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C54H31N5/c1-55-36-22-27-49-46(32-36)45-30-34(21-26-48(45)59(49)37-14-6-3-7-15-37)38-24-25-39(41-17-9-8-16-40(38)41)35-20-23-42-47(31-35)58-52(33-12-4-2-5-13-33)51-44-19-11-29-57-54(44)53-43(50(42)51)18-10-28-56-53/h2-32H |
| InChIKey | YGCSEUBLPQPFQT-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.88 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|