C44H25N3S — CID 140784200
18-(6-isocyano-9-phenylcarbazol-3-yl)-14-phenyl-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene (PubChem CID 140784200) has the molecular formula C44H25N3S and a molecular weight of 627.77 g/mol. Its IUPAC name is 18-(6-isocyano-9-phenylcarbazol-3-yl)-14-phenyl-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene.
| Compound Name | 18-(6-isocyano-9-phenylcarbazol-3-yl)-14-phenyl-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene |
|---|---|
| PubChem CID | 140784200 |
| Molecular Formula | C44H25N3S |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.18 |
| IUPAC Name | 18-(6-isocyano-9-phenylcarbazol-3-yl)-14-phenyl-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16(21),17,19-decaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1cc(-c3ccc4c(c3)nc(-c3ccccc3)c3ccc5c6ccccc6sc5c34)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C44H25N3S/c1-45-30-18-23-40-37(26-30)36-24-28(17-22-39(36)47(40)31-12-6-3-7-13-31)29-16-19-34-38(25-29)46-43(27-10-4-2-5-11-27)35-21-20-33-32-14-8-9-15-41(32)48-44(33)42(34)35/h2-26H |
| InChIKey | FZNUOQKBOYXWSB-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|