C55H64Br2N4 — CID 147377581
9-(1-aminooctyl)-2-N,7-N-bis(4-bromophenyl)-2-N,7-N-bis(4-methylphenyl)-9-N-octylfluorene-2,7,9-triamine (PubChem CID 147377581) has the molecular formula C55H64Br2N4 and a molecular weight of 940.95 g/mol. Its IUPAC name is 9-(1-aminooctyl)-2-N,7-N-bis(4-bromophenyl)-2-N,7-N-bis(4-methylphenyl)-9-N-octylfluorene-2,7,9-triamine.
| Compound Name | 9-(1-aminooctyl)-2-N,7-N-bis(4-bromophenyl)-2-N,7-N-bis(4-methylphenyl)-9-N-octylfluorene-2,7,9-triamine |
|---|---|
| PubChem CID | 147377581 |
| Molecular Formula | C55H64Br2N4 |
| Molecular Weight | 940.95 g/mol |
| Exact Mass | 938.35 |
| IUPAC Name | 9-(1-aminooctyl)-2-N,7-N-bis(4-bromophenyl)-2-N,7-N-bis(4-methylphenyl)-9-N-octylfluorene-2,7,9-triamine |
| SMILES | CCCCCCCCNC1(C(N)CCCCCCC)c2cc(N(c3ccc(C)cc3)c3ccc(Br)cc3)ccc2-c2ccc(N(c3ccc(C)cc3)c3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C55H64Br2N4/c1-5-7-9-11-13-15-37-59-55(54(58)16-14-12-10-8-6-2)52-38-48(60(44-25-17-40(3)18-26-44)46-29-21-42(56)22-30-46)33-35-50(52)51-36-34-49(39-53(51)55)61(45-27-19-41(4)20-28-45)47-31-23-43(57)24-32-47/h17-36,38-39,54,59H,5-16,37,58H2,1-4H3 |
| InChIKey | DKHZTUZEMQIIKJ-UHFFFAOYSA-N |
| XLogP | 16.63 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.95 |
| LogP ≤ 5 | 16.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|