C69H96N6 — CID 134368537
9-(1-aminooctyl)-2-N,7-N-bis[4-(butylamino)phenyl]-2-N,7-N-bis(4-tert-butylphenyl)-9-N-octylfluorene-2,7,9-triamine (PubChem CID 134368537) has the molecular formula C69H96N6 and a molecular weight of 1009.57 g/mol. Its IUPAC name is 9-(1-aminooctyl)-2-N,7-N-bis[4-(butylamino)phenyl]-2-N,7-N-bis(4-tert-butylphenyl)-9-N-octylfluorene-2,7,9-triamine.
| Compound Name | 9-(1-aminooctyl)-2-N,7-N-bis[4-(butylamino)phenyl]-2-N,7-N-bis(4-tert-butylphenyl)-9-N-octylfluorene-2,7,9-triamine |
|---|---|
| PubChem CID | 134368537 |
| Molecular Formula | C69H96N6 |
| Molecular Weight | 1009.57 g/mol |
| Exact Mass | 1008.77 |
| IUPAC Name | 9-(1-aminooctyl)-2-N,7-N-bis[4-(butylamino)phenyl]-2-N,7-N-bis(4-tert-butylphenyl)-9-N-octylfluorene-2,7,9-triamine |
| SMILES | CCCCCCCCNC1(C(N)CCCCCCC)c2cc(N(c3ccc(NCCCC)cc3)c3ccc(C(C)(C)C)cc3)ccc2-c2ccc(N(c3ccc(NCCCC)cc3)c3ccc(C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C69H96N6/c1-11-15-19-21-23-25-49-73-69(66(70)26-24-22-20-16-12-2)64-50-60(74(56-35-27-52(28-36-56)67(5,6)7)58-39-31-54(32-40-58)71-47-17-13-3)43-45-62(64)63-46-44-61(51-65(63)69)75(57-37-29-53(30-38-57)68(8,9)10)59-41-33-55(34-42-59)72-48-18-14-4/h27-46,50-51,66,71-73H,11-26,47-49,70H2,1-10H3 |
| InChIKey | QBGMYOKOUSYHJX-UHFFFAOYSA-N |
| XLogP | 19.51 |
| TPSA | 68.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.57 |
| LogP ≤ 5 | 19.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|