C57H64Br2N2 — CID 144813753
2-N,7-N-bis(4-bromophenyl)-9-(2-methylidenenonyl)-2-N,7-N-bis(4-methylphenyl)-9-octylfluorene-2,7-diamine (PubChem CID 144813753) has the molecular formula C57H64Br2N2 and a molecular weight of 936.96 g/mol. Its IUPAC name is 2-N,7-N-bis(4-bromophenyl)-9-(2-methylidenenonyl)-2-N,7-N-bis(4-methylphenyl)-9-octylfluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(4-bromophenyl)-9-(2-methylidenenonyl)-2-N,7-N-bis(4-methylphenyl)-9-octylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 144813753 |
| Molecular Formula | C57H64Br2N2 |
| Molecular Weight | 936.96 g/mol |
| Exact Mass | 934.34 |
| IUPAC Name | 2-N,7-N-bis(4-bromophenyl)-9-(2-methylidenenonyl)-2-N,7-N-bis(4-methylphenyl)-9-octylfluorene-2,7-diamine |
| SMILES | C=C(CCCCCCC)CC1(CCCCCCCC)c2cc(N(c3ccc(C)cc3)c3ccc(Br)cc3)ccc2-c2ccc(N(c3ccc(C)cc3)c3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C57H64Br2N2/c1-6-8-10-12-14-16-38-57(41-44(5)17-15-13-11-9-7-2)55-39-51(60(47-26-18-42(3)19-27-47)49-30-22-45(58)23-31-49)34-36-53(55)54-37-35-52(40-56(54)57)61(48-28-20-43(4)21-29-48)50-32-24-46(59)25-33-50/h18-37,39-40H,5-17,38,41H2,1-4H3 |
| InChIKey | HTIJAQNWPSWTTR-UHFFFAOYSA-N |
| XLogP | 19.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.96 |
| LogP ≤ 5 | 19.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|