C66H73N3 — CID 145194058
N-[4-[4-(N-[4-(2-aminopropan-2-yl)phenyl]anilino)phenyl]phenyl]-9-tert-butyl-7,7-dihexyl-N-phenylbenzo[c]fluoren-5-amine (PubChem CID 145194058) has the molecular formula C66H73N3 and a molecular weight of 908.33 g/mol. Its IUPAC name is N-[4-[4-(N-[4-(2-aminopropan-2-yl)phenyl]anilino)phenyl]phenyl]-9-tert-butyl-7,7-dihexyl-N-phenylbenzo[c]fluoren-5-amine.
| Compound Name | N-[4-[4-(N-[4-(2-aminopropan-2-yl)phenyl]anilino)phenyl]phenyl]-9-tert-butyl-7,7-dihexyl-N-phenylbenzo[c]fluoren-5-amine |
|---|---|
| PubChem CID | 145194058 |
| Molecular Formula | C66H73N3 |
| Molecular Weight | 908.33 g/mol |
| Exact Mass | 907.58 |
| IUPAC Name | N-[4-[4-(N-[4-(2-aminopropan-2-yl)phenyl]anilino)phenyl]phenyl]-9-tert-butyl-7,7-dihexyl-N-phenylbenzo[c]fluoren-5-amine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C(C)(C)C)ccc2-c2c1cc(N(c1ccccc1)c1ccc(-c3ccc(N(c4ccccc4)c4ccc(C(C)(C)N)cc4)cc3)cc1)c1ccccc21 |
| InChI | InChI=1S/C66H73N3/c1-8-10-12-22-44-66(45-23-13-11-9-2)60-46-51(64(3,4)5)36-43-59(60)63-58-29-21-20-28-57(58)62(47-61(63)66)69(53-26-18-15-19-27-53)56-39-32-49(33-40-56)48-30-37-54(38-31-48)68(52-24-16-14-17-25-52)55-41-34-50(35-42-55)65(6,7)67/h14-21,24-43,46-47H,8-13,22-23,44-45,67H2,1-7H3 |
| InChIKey | SNZLELMRYRTXIC-UHFFFAOYSA-N |
| XLogP | 19.15 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.33 |
| LogP ≤ 5 | 19.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|