C83H98B4N2 — CID 91043686
CID 91043686 (PubChem CID 91043686) has the molecular formula C83H98B4N2 and a molecular weight of 1166.96 g/mol.
| Compound Name | CID 91043686 |
|---|---|
| PubChem CID | 91043686 |
| Molecular Formula | C83H98B4N2 |
| Molecular Weight | 1166.96 g/mol |
| Exact Mass | 1166.81 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2c1cc(-c1ccc(N(c3ccc(-c4ccc(N(c5ccc(C)cc5)c5c(C)cc(C(C)(C)C)cc5C)cc4)cc3)c3c(C)cc(C(C)(C)C)cc3C)cc1)c1ccccc21.[B]B([B])[B] |
| InChI | InChI=1S/C83H98N2.B4/c1-15-17-19-21-23-27-49-83(50-28-24-22-20-18-16-2)76-51-58(4)33-48-74(76)78-73-30-26-25-29-72(73)75(56-77(78)83)65-38-46-71(47-39-65)85(80-61(7)54-67(55-62(80)8)82(12,13)14)70-44-36-64(37-45-70)63-34-42-69(43-35-63)84(68-40-31-57(3)32-41-68)79-59(5)52-66(53-60(79)6)81(9,10)11;1-4(2)3/h25-26,29-48,51-56H,15-24,27-28,49-50H2,1-14H3; |
| InChIKey | MHIFIHCKXGZZSB-UHFFFAOYSA-N |
| XLogP | 23.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1166.96 |
| LogP ≤ 5 | 23.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|