C49H57N — CID 146208407
2,7-ditert-butyl-9-(4-ethenylphenyl)-9-hexyl-N,N-bis(4-methylphenyl)fluoren-4-amine (PubChem CID 146208407) has the molecular formula C49H57N and a molecular weight of 660.00 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-(4-ethenylphenyl)-9-hexyl-N,N-bis(4-methylphenyl)fluoren-4-amine.
| Compound Name | 2,7-ditert-butyl-9-(4-ethenylphenyl)-9-hexyl-N,N-bis(4-methylphenyl)fluoren-4-amine |
|---|---|
| PubChem CID | 146208407 |
| Molecular Formula | C49H57N |
| Molecular Weight | 660.00 g/mol |
| Exact Mass | 659.45 |
| IUPAC Name | 2,7-ditert-butyl-9-(4-ethenylphenyl)-9-hexyl-N,N-bis(4-methylphenyl)fluoren-4-amine |
| SMILES | C=Cc1ccc(C2(CCCCCC)c3cc(C(C)(C)C)ccc3-c3c(N(c4ccc(C)cc4)c4ccc(C)cc4)cc(C(C)(C)C)cc32)cc1 |
| InChI | InChI=1S/C49H57N/c1-11-13-14-15-30-49(37-22-20-36(12-2)21-23-37)43-31-38(47(5,6)7)24-29-42(43)46-44(49)32-39(48(8,9)10)33-45(46)50(40-25-16-34(3)17-26-40)41-27-18-35(4)19-28-41/h12,16-29,31-33H,2,11,13-15,30H2,1,3-10H3 |
| InChIKey | RNPQYKRNHRJOAE-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.00 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|