C29H33N3 — CID 89274046
9-(4-azidophenyl)-2,7-dimethyl-9-octylfluorene (PubChem CID 89274046) has the molecular formula C29H33N3 and a molecular weight of 423.60 g/mol. Its IUPAC name is 9-(4-azidophenyl)-2,7-dimethyl-9-octylfluorene.
| Compound Name | 9-(4-azidophenyl)-2,7-dimethyl-9-octylfluorene |
|---|---|
| PubChem CID | 89274046 |
| Molecular Formula | C29H33N3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 9-(4-azidophenyl)-2,7-dimethyl-9-octylfluorene |
| SMILES | CCCCCCCCC1(c2ccc(N=[N+]=[N-])cc2)c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C29H33N3/c1-4-5-6-7-8-9-18-29(23-12-14-24(15-13-23)31-32-30)27-19-21(2)10-16-25(27)26-17-11-22(3)20-28(26)29/h10-17,19-20H,4-9,18H2,1-3H3 |
| InChIKey | OFYIWZZNQJKBEH-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|