C43H52Br2 — CID 123792037
9,9-bis(6-bromohexyl)-2,7-bis(2-phenylpropan-2-yl)fluorene (PubChem CID 123792037) has the molecular formula C43H52Br2 and a molecular weight of 728.70 g/mol. Its IUPAC name is 9,9-bis(6-bromohexyl)-2,7-bis(2-phenylpropan-2-yl)fluorene.
| Compound Name | 9,9-bis(6-bromohexyl)-2,7-bis(2-phenylpropan-2-yl)fluorene |
|---|---|
| PubChem CID | 123792037 |
| Molecular Formula | C43H52Br2 |
| Molecular Weight | 728.70 g/mol |
| Exact Mass | 726.24 |
| IUPAC Name | 9,9-bis(6-bromohexyl)-2,7-bis(2-phenylpropan-2-yl)fluorene |
| SMILES | CC(C)(c1ccccc1)c1ccc2c(c1)C(CCCCCCBr)(CCCCCCBr)c1cc(C(C)(C)c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C43H52Br2/c1-41(2,33-19-11-9-12-20-33)35-23-25-37-38-26-24-36(42(3,4)34-21-13-10-14-22-34)32-40(38)43(39(37)31-35,27-15-5-7-17-29-44)28-16-6-8-18-30-45/h9-14,19-26,31-32H,5-8,15-18,27-30H2,1-4H3 |
| InChIKey | XYMSOCALOWMZOV-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.70 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|