C31H48NO3+ — CID 153278370
6-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-dimethylfluoren-9-yl]hexyl-trimethylazanium (PubChem CID 153278370) has the molecular formula C31H48NO3+ and a molecular weight of 482.73 g/mol. Its IUPAC name is 6-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-dimethylfluoren-9-yl]hexyl-trimethylazanium.
| Compound Name | 6-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-dimethylfluoren-9-yl]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 153278370 |
| Molecular Formula | C31H48NO3+ |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | 6-[9-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2,7-dimethylfluoren-9-yl]hexyl-trimethylazanium |
| SMILES | COCCOCCOCCC1(CCCCCC[N+](C)(C)C)c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C31H48NO3/c1-25-11-13-27-28-14-12-26(2)24-30(28)31(29(27)23-25,15-9-7-8-10-17-32(3,4)5)16-18-34-21-22-35-20-19-33-6/h11-14,23-24H,7-10,15-22H2,1-6H3/q+1 |
| InChIKey | QVBWFEHIFFOZBI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|