C55H64N2O6 — CID 134222945
9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine (PubChem CID 134222945) has the molecular formula C55H64N2O6 and a molecular weight of 849.12 g/mol. Its IUPAC name is 9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine.
| Compound Name | 9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 134222945 |
| Molecular Formula | C55H64N2O6 |
| Molecular Weight | 849.12 g/mol |
| Exact Mass | 848.48 |
| IUPAC Name | 9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine |
| SMILES | COCCOCCOCCC1(CCOCCOCCOC)c2cc(N(c3ccc(C)cc3)c3ccc(C)cc3)ccc2-c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C55H64N2O6/c1-41-7-15-45(16-8-41)56(46-17-9-42(2)10-18-46)49-23-25-51-52-26-24-50(57(47-19-11-43(3)12-20-47)48-21-13-44(4)14-22-48)40-54(52)55(53(51)39-49,27-29-60-35-37-62-33-31-58-5)28-30-61-36-38-63-34-32-59-6/h7-26,39-40H,27-38H2,1-6H3 |
| InChIKey | UTABDORMSIMGMQ-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.12 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|