C29H46B2O10 — CID 145347180
[7-borono-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]boronic acid;ethane (PubChem CID 145347180) has the molecular formula C29H46B2O10 and a molecular weight of 576.30 g/mol. Its IUPAC name is [7-borono-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]boronic acid;ethane.
| Compound Name | [7-borono-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]boronic acid;ethane |
|---|---|
| PubChem CID | 145347180 |
| Molecular Formula | C29H46B2O10 |
| Molecular Weight | 576.30 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | [7-borono-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]boronic acid;ethane |
| SMILES | CC.COCCOCCOCCC1(CCOCCOCCOC)c2cc(B(O)O)ccc2-c2ccc(B(O)O)cc21 |
| InChI | InChI=1S/C27H40B2O10.C2H6/c1-34-11-13-38-17-15-36-9-7-27(8-10-37-16-18-39-14-12-35-2)25-19-21(28(30)31)3-5-23(25)24-6-4-22(29(32)33)20-26(24)27;1-2/h3-6,19-20,30-33H,7-18H2,1-2H3;1-2H3 |
| InChIKey | UPHOEVDPOSJSIR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|