C25H28Br2O3 — CID 126558449
ethyl 2-(2,7-dibromo-9-octylfluoren-9-yl)-2-oxoacetate (PubChem CID 126558449) has the molecular formula C25H28Br2O3 and a molecular weight of 536.30 g/mol. Its IUPAC name is ethyl 2-(2,7-dibromo-9-octylfluoren-9-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(2,7-dibromo-9-octylfluoren-9-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 126558449 |
| Molecular Formula | C25H28Br2O3 |
| Molecular Weight | 536.30 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | ethyl 2-(2,7-dibromo-9-octylfluoren-9-yl)-2-oxoacetate |
| SMILES | CCCCCCCCC1(C(=O)C(=O)OCC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C25H28Br2O3/c1-3-5-6-7-8-9-14-25(23(28)24(29)30-4-2)21-15-17(26)10-12-19(21)20-13-11-18(27)16-22(20)25/h10-13,15-16H,3-9,14H2,1-2H3 |
| InChIKey | RTWRUYZPIYNIJS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.30 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|