C31H40Br2O3 — CID 126559622
ethyl 2-[2,7-dibromo-9-(2-hexyloctyl)fluoren-9-yl]-2-oxoacetate (PubChem CID 126559622) has the molecular formula C31H40Br2O3 and a molecular weight of 620.47 g/mol. Its IUPAC name is ethyl 2-[2,7-dibromo-9-(2-hexyloctyl)fluoren-9-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2,7-dibromo-9-(2-hexyloctyl)fluoren-9-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 126559622 |
| Molecular Formula | C31H40Br2O3 |
| Molecular Weight | 620.47 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | ethyl 2-[2,7-dibromo-9-(2-hexyloctyl)fluoren-9-yl]-2-oxoacetate |
| SMILES | CCCCCCC(CCCCCC)CC1(C(=O)C(=O)OCC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C31H40Br2O3/c1-4-7-9-11-13-22(14-12-10-8-5-2)21-31(29(34)30(35)36-6-3)27-19-23(32)15-17-25(27)26-18-16-24(33)20-28(26)31/h15-20,22H,4-14,21H2,1-3H3 |
| InChIKey | DXZIFMDCXRESBE-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.47 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|