C38H60BrN — CID 141406321
7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine (PubChem CID 141406321) has the molecular formula C38H60BrN and a molecular weight of 610.81 g/mol. Its IUPAC name is 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine.
| Compound Name | 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine |
|---|---|
| PubChem CID | 141406321 |
| Molecular Formula | C38H60BrN |
| Molecular Weight | 610.81 g/mol |
| Exact Mass | 609.39 |
| IUPAC Name | 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine |
| SMILES | CCCCCCC(CCCC)CC1(CC(CCCC)CCCCCC)c2cc(Br)ccc2-c2c(C)cc(N)cc21 |
| InChI | InChI=1S/C38H60BrN/c1-6-10-14-16-20-30(18-12-8-3)27-38(28-31(19-13-9-4)21-17-15-11-7-2)35-25-32(39)22-23-34(35)37-29(5)24-33(40)26-36(37)38/h22-26,30-31H,6-21,27-28,40H2,1-5H3 |
| InChIKey | DYGVXFBTYSWDRG-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.81 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|