About 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine
7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine (PubChem CID 141406321) has the molecular formula C38H60BrN
and a molecular weight of 610.81 g/mol. Its IUPAC name is 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine.
Molecular Properties
| Compound Name | 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine |
| PubChem CID | 141406321 |
| Molecular Formula | C38H60BrN |
| Molecular Weight | 610.81 g/mol |
| Exact Mass | 609.39 |
| IUPAC Name | 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine |
| SMILES | CCCCCCC(CCCC)CC1(CC(CCCC)CCCCCC)c2cc(Br)ccc2-c2c(C)cc(N)cc21 |
| InChI | InChI=1S/C38H60BrN/c1-6-10-14-16-20-30(18-12-8-3)27-38(28-31(19-13-9-4)21-17-15-11-7-2)35-25-32(39)22-23-34(35)37-29(5)24-33(40)26-36(37)38/h22-26,30-31H,6-21,27-28,40H2,1-5H3 |
| InChIKey | DYGVXFBTYSWDRG-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.81 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine?
The IUPAC name of 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine (CID 141406321) is 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine.
What is the SMILES notation for 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine?
The canonical SMILES for 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine is CCCCCCC(CCCC)CC1(CC(CCCC)CCCCCC)c2cc(Br)ccc2-c2c(C)cc(N)cc21.
What is the InChIKey of 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine?
The InChIKey is DYGVXFBTYSWDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H60BrN/c1-6-10-14-16-20-30(18-12-8-3)27-38(28-31(19-13-9-4)21-17-15-11-7-2)35-25-32(39)22-23-34(35)37-29(5)24-33(40)26-36(37)38/h22-26,30-31H,6-21,27-28,40H2,1-5H3.
What are the key properties of 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine?
7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine has a molecular weight of 610.81 g/mol, XLogP of 12.94, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-9,9-bis(2-butyloctyl)-4-methylfluoren-2-amine is sourced from PubChem (CID 141406321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).