C31H44Br2 — CID 101119414
2,7-dibromo-9,9-bis[(2S)-2-methyloctyl]fluorene (PubChem CID 101119414) has the molecular formula C31H44Br2 and a molecular weight of 576.50 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis[(2S)-2-methyloctyl]fluorene.
| Compound Name | 2,7-dibromo-9,9-bis[(2S)-2-methyloctyl]fluorene |
|---|---|
| PubChem CID | 101119414 |
| Molecular Formula | C31H44Br2 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 2,7-dibromo-9,9-bis[(2S)-2-methyloctyl]fluorene |
| SMILES | CCCCCC[C@H](C)CC1(C[C@@H](C)CCCCCC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C31H44Br2/c1-5-7-9-11-13-23(3)21-31(22-24(4)14-12-10-8-6-2)29-19-25(32)15-17-27(29)28-18-16-26(33)20-30(28)31/h15-20,23-24H,5-14,21-22H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | ZCIJRHDGRDOVIC-ZEQRLZLVSA-N |
| XLogP | 11.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|