C43H52B2O2 — CID 123510218
CID 123510218 (PubChem CID 123510218) has the molecular formula C43H52B2O2 and a molecular weight of 622.51 g/mol.
| Compound Name | CID 123510218 |
|---|---|
| PubChem CID | 123510218 |
| Molecular Formula | C43H52B2O2 |
| Molecular Weight | 622.51 g/mol |
| Exact Mass | 622.42 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(c1ccc(CCCCCC)cc1)(c1ccc(CCCCCC)cc1)c1cc(B3OC(C)(C)C(C)(C)O3)ccc1-2 |
| InChI | InChI=1S/C43H52B2O2/c1-7-9-11-13-15-31-17-21-33(22-18-31)43(34-23-19-32(20-24-34)16-14-12-10-8-2)39-29-35(44)25-27-37(39)38-28-26-36(30-40(38)43)45-46-41(3,4)42(5,6)47-45/h17-30H,7-16H2,1-6H3 |
| InChIKey | BSJYQWFWNUEQCK-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.51 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|