C61H72B2O4 — CID 71006632
2-[9,9-bis[3-(3-hexylphenyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 71006632) has the molecular formula C61H72B2O4 and a molecular weight of 890.87 g/mol. Its IUPAC name is 2-[9,9-bis[3-(3-hexylphenyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,9-bis[3-(3-hexylphenyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 71006632 |
| Molecular Formula | C61H72B2O4 |
| Molecular Weight | 890.87 g/mol |
| Exact Mass | 890.56 |
| IUPAC Name | 2-[9,9-bis[3-(3-hexylphenyl)phenyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCc1cccc(-c2cccc(C3(c4cccc(-c5cccc(CCCCCC)c5)c4)c4cc(B5OC(C)(C)C(C)(C)O5)ccc4-c4ccc(B5OC(C)(C)C(C)(C)O5)cc43)c2)c1 |
| InChI | InChI=1S/C61H72B2O4/c1-11-13-15-17-23-43-25-19-27-45(37-43)47-29-21-31-49(39-47)61(50-32-22-30-48(40-50)46-28-20-26-44(38-46)24-18-16-14-12-2)55-41-51(62-64-57(3,4)58(5,6)65-62)33-35-53(55)54-36-34-52(42-56(54)61)63-66-59(7,8)60(9,10)67-63/h19-22,25-42H,11-18,23-24H2,1-10H3 |
| InChIKey | QNZKXKXDTMIKDY-UHFFFAOYSA-N |
| XLogP | 14.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.87 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|