C30H35BO3 — CID 139257864
2-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139257864) has the molecular formula C30H35BO3 and a molecular weight of 454.42 g/mol. Its IUPAC name is 2-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139257864 |
| Molecular Formula | C30H35BO3 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 2-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC1(CC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(-c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C30H35BO3/c1-8-30(9-2)26-18-21(20-10-14-23(32-7)15-11-20)12-16-24(26)25-17-13-22(19-27(25)30)31-33-28(3,4)29(5,6)34-31/h10-19H,8-9H2,1-7H3 |
| InChIKey | YQMKDBOEEYBUIE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|