C54H51BrO2 — CID 139257861
2-[6-(3-bromopropoxy)naphthalen-2-yl]-7-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-9,9-diethylfluorene (PubChem CID 139257861) has the molecular formula C54H51BrO2 and a molecular weight of 811.90 g/mol. Its IUPAC name is 2-[6-(3-bromopropoxy)naphthalen-2-yl]-7-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-9,9-diethylfluorene.
| Compound Name | 2-[6-(3-bromopropoxy)naphthalen-2-yl]-7-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-9,9-diethylfluorene |
|---|---|
| PubChem CID | 139257861 |
| Molecular Formula | C54H51BrO2 |
| Molecular Weight | 811.90 g/mol |
| Exact Mass | 810.31 |
| IUPAC Name | 2-[6-(3-bromopropoxy)naphthalen-2-yl]-7-[9,9-diethyl-7-(4-methoxyphenyl)fluoren-2-yl]-9,9-diethylfluorene |
| SMILES | CCC1(CC)c2cc(-c3ccc(OC)cc3)ccc2-c2ccc(-c3ccc4c(c3)C(CC)(CC)c3cc(-c5ccc6cc(OCCCBr)ccc6c5)ccc3-4)cc21 |
| InChI | InChI=1S/C54H51BrO2/c1-6-53(7-2)49-31-39(35-13-20-43(56-5)21-14-35)16-23-45(49)47-25-18-41(33-51(47)53)42-19-26-48-46-24-17-40(32-50(46)54(8-3,9-4)52(48)34-42)36-11-12-38-30-44(57-28-10-27-55)22-15-37(38)29-36/h11-26,29-34H,6-10,27-28H2,1-5H3 |
| InChIKey | USYFJIRAVFSRFY-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.90 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|