C78H70O2 — CID 59858796
2-[3-[3,5-bis(9,9-diethylfluoren-2-yl)phenyl]-5-(7-methoxy-9,9-dimethylfluoren-2-yl)phenyl]-7-methoxy-9,9-dimethylfluorene (PubChem CID 59858796) has the molecular formula C78H70O2 and a molecular weight of 1039.42 g/mol. Its IUPAC name is 2-[3-[3,5-bis(9,9-diethylfluoren-2-yl)phenyl]-5-(7-methoxy-9,9-dimethylfluoren-2-yl)phenyl]-7-methoxy-9,9-dimethylfluorene.
| Compound Name | 2-[3-[3,5-bis(9,9-diethylfluoren-2-yl)phenyl]-5-(7-methoxy-9,9-dimethylfluoren-2-yl)phenyl]-7-methoxy-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 59858796 |
| Molecular Formula | C78H70O2 |
| Molecular Weight | 1039.42 g/mol |
| Exact Mass | 1038.54 |
| IUPAC Name | 2-[3-[3,5-bis(9,9-diethylfluoren-2-yl)phenyl]-5-(7-methoxy-9,9-dimethylfluoren-2-yl)phenyl]-7-methoxy-9,9-dimethylfluorene |
| SMILES | CCC1(CC)c2ccccc2-c2ccc(-c3cc(-c4cc(-c5ccc6c(c5)C(C)(C)c5cc(OC)ccc5-6)cc(-c5ccc6c(c5)C(C)(C)c5cc(OC)ccc5-6)c4)cc(-c4ccc5c(c4)C(CC)(CC)c4ccccc4-5)c3)cc21 |
| InChI | InChI=1S/C78H70O2/c1-11-77(12-2)67-21-17-15-19-59(67)65-31-25-49(43-73(65)77)53-36-54(50-26-32-66-60-20-16-18-22-68(60)78(13-3,14-4)74(66)44-50)40-56(39-53)55-37-51(47-23-29-61-63-33-27-57(79-9)45-71(63)75(5,6)69(61)41-47)35-52(38-55)48-24-30-62-64-34-28-58(80-10)46-72(64)76(7,8)70(62)42-48/h15-46H,11-14H2,1-10H3 |
| InChIKey | DEDHVNFNTCUMCG-UHFFFAOYSA-N |
| XLogP | 20.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.42 |
| LogP ≤ 5 | 20.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |