C37H30O2 — CID 90394308
2,7-bis(6-methoxynaphthalen-2-yl)-9,9-dimethylfluorene (PubChem CID 90394308) has the molecular formula C37H30O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2,7-bis(6-methoxynaphthalen-2-yl)-9,9-dimethylfluorene.
| Compound Name | 2,7-bis(6-methoxynaphthalen-2-yl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 90394308 |
| Molecular Formula | C37H30O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2,7-bis(6-methoxynaphthalen-2-yl)-9,9-dimethylfluorene |
| SMILES | COc1ccc2cc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6cc(OC)ccc6c5)ccc3-4)ccc2c1 |
| InChI | InChI=1S/C37H30O2/c1-37(2)35-21-29(23-5-7-27-19-31(38-3)13-9-25(27)17-23)11-15-33(35)34-16-12-30(22-36(34)37)24-6-8-28-20-32(39-4)14-10-26(28)18-24/h5-22H,1-4H3 |
| InChIKey | KCIBNVGDPQIDMY-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |