C57H70BNO4 — CID 164780012
9-[[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]methyl]-9-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carbonitrile (PubChem CID 164780012) has the molecular formula C57H70BNO4 and a molecular weight of 844.00 g/mol. Its IUPAC name is 9-[[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]methyl]-9-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carbonitrile.
| Compound Name | 9-[[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]methyl]-9-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 164780012 |
| Molecular Formula | C57H70BNO4 |
| Molecular Weight | 844.00 g/mol |
| Exact Mass | 843.54 |
| IUPAC Name | 9-[[3,5-bis[4-(2-ethylhexoxy)phenyl]phenyl]methyl]-9-ethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carbonitrile |
| SMILES | CCCCC(CC)COc1ccc(-c2cc(CC3(CC)c4cc(C#N)ccc4-c4ccc(B5OC(C)(C)C(C)(C)O5)cc43)cc(-c3ccc(OCC(CC)CCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C57H70BNO4/c1-10-15-17-40(12-3)38-60-49-25-20-44(21-26-49)46-31-43(32-47(34-46)45-22-27-50(28-23-45)61-39-41(13-4)18-16-11-2)36-57(14-5)53-33-42(37-59)19-29-51(53)52-30-24-48(35-54(52)57)58-62-55(6,7)56(8,9)63-58/h19-35,40-41H,10-18,36,38-39H2,1-9H3 |
| InChIKey | UNYWGLDVFSYZNI-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.00 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|