C13H16BNO2S — CID 162366794
6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-methyl-1,3-benzothiazole (PubChem CID 162366794) has the molecular formula C13H16BNO2S and a molecular weight of 261.15 g/mol. Its IUPAC name is 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-methyl-1,3-benzothiazole.
| Compound Name | 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 162366794 |
| Molecular Formula | C13H16BNO2S |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2ccc(B3OCC(C)(C)CO3)cc2s1 |
| InChI | InChI=1S/C13H16BNO2S/c1-9-15-11-5-4-10(6-12(11)18-9)14-16-7-13(2,3)8-17-14/h4-6H,7-8H2,1-3H3 |
| InChIKey | XMMJLURLBPNLBG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|