C14H20BNO2 — CID 141151193
6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 141151193) has the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. Its IUPAC name is 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 141151193 |
| Molecular Formula | C14H20BNO2 |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1(C)COB(c2ccc3c(c2)CCCN3)OC1 |
| InChI | InChI=1S/C14H20BNO2/c1-14(2)9-17-15(18-10-14)12-5-6-13-11(8-12)4-3-7-16-13/h5-6,8,16H,3-4,7,9-10H2,1-2H3 |
| InChIKey | POUQQLHSCADDPK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|