About 1-benzothiophen-5-yl acetate
1-benzothiophen-5-yl acetate (PubChem CID 15501124) has the molecular formula C10H8O2S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 1-benzothiophen-5-yl acetate.
Molecular Properties
| Compound Name | 1-benzothiophen-5-yl acetate |
| PubChem CID | 15501124 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 1-benzothiophen-5-yl acetate |
| SMILES | CC(=O)Oc1ccc2sccc2c1 |
| InChI | InChI=1S/C10H8O2S/c1-7(11)12-9-2-3-10-8(6-9)4-5-13-10/h2-6H,1H3 |
| InChIKey | HYPMZNIJCJSNFI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophen-5-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-5-yl acetate?
The IUPAC name of 1-benzothiophen-5-yl acetate (CID 15501124) is 1-benzothiophen-5-yl acetate.
What is the SMILES notation for 1-benzothiophen-5-yl acetate?
The canonical SMILES for 1-benzothiophen-5-yl acetate is CC(=O)Oc1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophen-5-yl acetate?
The InChIKey is HYPMZNIJCJSNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2S/c1-7(11)12-9-2-3-10-8(6-9)4-5-13-10/h2-6H,1H3.
What are the key properties of 1-benzothiophen-5-yl acetate?
1-benzothiophen-5-yl acetate has a molecular weight of 192.24 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-5-yl acetate is sourced from PubChem (CID 15501124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).