About 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate
1-benzothiophen-5-yl difluoromethyl hydrogen phosphate (PubChem CID 175962330) has the molecular formula C9H7F2O4PS
and a molecular weight of 280.19 g/mol. Its IUPAC name is 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate.
Molecular Properties
| Compound Name | 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate |
| PubChem CID | 175962330 |
| Molecular Formula | C9H7F2O4PS |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate |
| SMILES | O=P(O)(Oc1ccc2sccc2c1)OC(F)F |
| InChI | InChI=1S/C9H7F2O4PS/c10-9(11)15-16(12,13)14-7-1-2-8-6(5-7)3-4-17-8/h1-5,9H,(H,12,13) |
| InChIKey | JREJKKGWSZNPGG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate?
The IUPAC name of 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate (CID 175962330) is 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate.
What is the SMILES notation for 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate?
The canonical SMILES for 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate is O=P(O)(Oc1ccc2sccc2c1)OC(F)F.
What is the InChIKey of 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate?
The InChIKey is JREJKKGWSZNPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2O4PS/c10-9(11)15-16(12,13)14-7-1-2-8-6(5-7)3-4-17-8/h1-5,9H,(H,12,13).
What are the key properties of 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate?
1-benzothiophen-5-yl difluoromethyl hydrogen phosphate has a molecular weight of 280.19 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-5-yl difluoromethyl hydrogen phosphate is sourced from PubChem (CID 175962330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).