C16H14O5 — CID 122603285
[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-hydroxyphenyl] acetate (PubChem CID 122603285) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 122603285 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1O |
| InChI | InChI=1S/C16H14O5/c1-10(17)21-16-5-4-11(8-15(16)20)2-3-12-6-13(18)9-14(19)7-12/h2-9,18-20H,1H3/b3-2+ |
| InChIKey | ILUBZKFPPCLHPS-NSCUHMNNSA-N |
| XLogP | 2.90 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|