C34H30O5P+ — CID 71452155
3-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyacetyl]oxypropyl-triphenylphosphanium (PubChem CID 71452155) has the molecular formula C34H30O5P+ and a molecular weight of 549.58 g/mol. Its IUPAC name is 3-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyacetyl]oxypropyl-triphenylphosphanium.
| Compound Name | 3-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyacetyl]oxypropyl-triphenylphosphanium |
|---|---|
| PubChem CID | 71452155 |
| Molecular Formula | C34H30O5P+ |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 3-[2-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyacetyl]oxypropyl-triphenylphosphanium |
| SMILES | CC1=C(OCC(=O)OCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C34H30O5P/c1-25-32(36)29-20-11-12-21-30(29)33(37)34(25)39-24-31(35)38-22-13-23-40(26-14-5-2-6-15-26,27-16-7-3-8-17-27)28-18-9-4-10-19-28/h2-12,14-21H,13,22-24H2,1H3/q+1 |
| InChIKey | OPZXHSGHPNBCNM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|