C14H15BrO5 — CID 123795633
3-bromopropyl 2-(2-methyl-4,5-dimethylidene-3,6-dioxocyclohexen-1-yl)oxyacetate (PubChem CID 123795633) has the molecular formula C14H15BrO5 and a molecular weight of 343.17 g/mol. Its IUPAC name is 3-bromopropyl 2-(2-methyl-4,5-dimethylidene-3,6-dioxocyclohexen-1-yl)oxyacetate.
| Compound Name | 3-bromopropyl 2-(2-methyl-4,5-dimethylidene-3,6-dioxocyclohexen-1-yl)oxyacetate |
|---|---|
| PubChem CID | 123795633 |
| Molecular Formula | C14H15BrO5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-bromopropyl 2-(2-methyl-4,5-dimethylidene-3,6-dioxocyclohexen-1-yl)oxyacetate |
| SMILES | C=C1C(=C)C(=O)C(OCC(=O)OCCCBr)=C(C)C1=O |
| InChI | InChI=1S/C14H15BrO5/c1-8-9(2)13(18)14(10(3)12(8)17)20-7-11(16)19-6-4-5-15/h1-2,4-7H2,3H3 |
| InChIKey | BTBDXKXEJHHPSW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|