C11H16FN3O3S — CID 55102606
4-[(4-fluoro-2-methylphenyl)sulfonylamino]-N'-hydroxybutanimidamide (PubChem CID 55102606) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methylphenyl)sulfonylamino]-N'-hydroxybutanimidamide.
| Compound Name | 4-[(4-fluoro-2-methylphenyl)sulfonylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 55102606 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(4-fluoro-2-methylphenyl)sulfonylamino]-N'-hydroxybutanimidamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCCC/C(N)=N/O |
| InChI | InChI=1S/C11H16FN3O3S/c1-8-7-9(12)4-5-10(8)19(17,18)14-6-2-3-11(13)15-16/h4-5,7,14,16H,2-3,6H2,1H3,(H2,13,15) |
| InChIKey | YYRKFXSRSBKOCG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|