C10H14ClN3O3S — CID 76948260
4-[(2-chlorophenyl)sulfonylamino]-N'-hydroxybutanimidamide (PubChem CID 76948260) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)sulfonylamino]-N'-hydroxybutanimidamide.
| Compound Name | 4-[(2-chlorophenyl)sulfonylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76948260 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-[(2-chlorophenyl)sulfonylamino]-N'-hydroxybutanimidamide |
| SMILES | NC(CCCNS(=O)(=O)c1ccccc1Cl)=NO |
| InChI | InChI=1S/C10H14ClN3O3S/c11-8-4-1-2-5-9(8)18(16,17)13-7-3-6-10(12)14-15/h1-2,4-5,13,15H,3,6-7H2,(H2,12,14) |
| InChIKey | FTWHKBCEYWXLLY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|