C12H13BrN2O2S2 — CID 63825079
4-bromo-3-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 63825079) has the molecular formula C12H13BrN2O2S2 and a molecular weight of 361.29 g/mol. Its IUPAC name is 4-bromo-3-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-3-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63825079 |
| Molecular Formula | C12H13BrN2O2S2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 4-bromo-3-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCc2cscn2)ccc1Br |
| InChI | InChI=1S/C12H13BrN2O2S2/c1-9-6-11(2-3-12(9)13)19(16,17)15-5-4-10-7-18-8-14-10/h2-3,6-8,15H,4-5H2,1H3 |
| InChIKey | DPIZLHGFACZTED-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |