C10H13N5O2S2 — CID 63826100
6-hydrazinyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 63826100) has the molecular formula C10H13N5O2S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 6-hydrazinyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63826100 |
| Molecular Formula | C10H13N5O2S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 6-hydrazinyl-N-[2-(1,3-thiazol-4-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)NCCc2cscn2)cn1 |
| InChI | InChI=1S/C10H13N5O2S2/c11-15-10-2-1-9(5-12-10)19(16,17)14-4-3-8-6-18-7-13-8/h1-2,5-7,14H,3-4,11H2,(H,12,15) |
| InChIKey | FPGPKWAKRYZXTK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|