C14H13F4N3O3S — CID 30948673
4-fluoro-N-[3-(6-oxopyridazin-1-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 30948673) has the molecular formula C14H13F4N3O3S and a molecular weight of 379.34 g/mol. Its IUPAC name is 4-fluoro-N-[3-(6-oxopyridazin-1-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-(6-oxopyridazin-1-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 30948673 |
| Molecular Formula | C14H13F4N3O3S |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-fluoro-N-[3-(6-oxopyridazin-1-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=c1cccnn1CCCNS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F4N3O3S/c15-12-5-4-10(9-11(12)14(16,17)18)25(23,24)20-7-2-8-21-13(22)3-1-6-19-21/h1,3-6,9,20H,2,7-8H2 |
| InChIKey | NTKPMLBQGDMFEY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|