C13H20N4O — CID 106751115
2-(3,4-diaminoanilino)-1-piperidin-1-ylethanone (PubChem CID 106751115) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-(3,4-diaminoanilino)-1-piperidin-1-ylethanone.
| Compound Name | 2-(3,4-diaminoanilino)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 106751115 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-(3,4-diaminoanilino)-1-piperidin-1-ylethanone |
| SMILES | Nc1ccc(NCC(=O)N2CCCCC2)cc1N |
| InChI | InChI=1S/C13H20N4O/c14-11-5-4-10(8-12(11)15)16-9-13(18)17-6-2-1-3-7-17/h4-5,8,16H,1-3,6-7,9,14-15H2 |
| InChIKey | HHYRDKQTVCADHW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|