C12H13Cl2NO — CID 82100516
2-(cyclopropylamino)-1-(2,4-dichlorophenyl)propan-1-one (PubChem CID 82100516) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is 2-(cyclopropylamino)-1-(2,4-dichlorophenyl)propan-1-one.
| Compound Name | 2-(cyclopropylamino)-1-(2,4-dichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 82100516 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-(cyclopropylamino)-1-(2,4-dichlorophenyl)propan-1-one |
| SMILES | CC(NC1CC1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO/c1-7(15-9-3-4-9)12(16)10-5-2-8(13)6-11(10)14/h2,5-7,9,15H,3-4H2,1H3 |
| InChIKey | XQSKLJWIZPOMDJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |