C14H16Cl2O3S — CID 64641187
1-(2,4-dichlorophenyl)-2-(oxan-4-ylsulfinyl)propan-1-one (PubChem CID 64641187) has the molecular formula C14H16Cl2O3S and a molecular weight of 335.25 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(oxan-4-ylsulfinyl)propan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(oxan-4-ylsulfinyl)propan-1-one |
|---|---|
| PubChem CID | 64641187 |
| Molecular Formula | C14H16Cl2O3S |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(oxan-4-ylsulfinyl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(Cl)cc1Cl)S(=O)C1CCOCC1 |
| InChI | InChI=1S/C14H16Cl2O3S/c1-9(20(18)11-4-6-19-7-5-11)14(17)12-3-2-10(15)8-13(12)16/h2-3,8-9,11H,4-7H2,1H3 |
| InChIKey | HARXROCTQQDQRU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |