C18H20O6 — CID 144606949
ethane;methyl 3-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate (PubChem CID 144606949) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is ethane;methyl 3-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate.
| Compound Name | ethane;methyl 3-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 144606949 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethane;methyl 3-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzoate |
| SMILES | CC.COC(=O)c1cccc(OCC(=O)c2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C16H14O6.C2H6/c1-21-16(20)10-3-2-4-12(7-10)22-9-15(19)13-6-5-11(17)8-14(13)18;1-2/h2-8,17-18H,9H2,1H3;1-2H3 |
| InChIKey | OEPMVYVDYHGCMQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |