C8H8O3 — CID 89199480
4-(1-hydroxyethenyl)benzene-1,3-diol (PubChem CID 89199480) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is 4-(1-hydroxyethenyl)benzene-1,3-diol.
| Compound Name | 4-(1-hydroxyethenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 89199480 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 4-(1-hydroxyethenyl)benzene-1,3-diol |
| SMILES | C=C(O)c1ccc(O)cc1O |
| InChI | InChI=1S/C8H8O3/c1-5(9)7-3-2-6(10)4-8(7)11/h2-4,9-11H,1H2 |
| InChIKey | LOJCOBLNZZEHPG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|