C16H16O5 — CID 162047317
1-(2,4-dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)prop-2-en-1-one;methane (PubChem CID 162047317) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)prop-2-en-1-one;methane.
| Compound Name | 1-(2,4-dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)prop-2-en-1-one;methane |
|---|---|
| PubChem CID | 162047317 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-2-(3,4-dihydroxyphenyl)prop-2-en-1-one;methane |
| SMILES | C.C=C(C(=O)c1ccc(O)cc1O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H12O5.CH4/c1-8(9-2-5-12(17)14(19)6-9)15(20)11-4-3-10(16)7-13(11)18;/h2-7,16-19H,1H2;1H4 |
| InChIKey | YYBJQTTVVKDTHL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|