C15H12O5 — CID 90286784
5-[1-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid (PubChem CID 90286784) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-[1-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[1-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 90286784 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 5-[1-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid |
| SMILES | C=C(c1ccc(O)c(C(=O)O)c1)c1cc(O)ccc1O |
| InChI | InChI=1S/C15H12O5/c1-8(11-7-10(16)3-5-13(11)17)9-2-4-14(18)12(6-9)15(19)20/h2-7,16-18H,1H2,(H,19,20) |
| InChIKey | MKJLNKHDYPRYTJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|