C10H13N3O2 — CID 136620654
N-(1-aminoethenyl)-2,4-dihydroxy-N'-methylbenzenecarboximidamide (PubChem CID 136620654) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(1-aminoethenyl)-2,4-dihydroxy-N'-methylbenzenecarboximidamide.
| Compound Name | N-(1-aminoethenyl)-2,4-dihydroxy-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 136620654 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-(1-aminoethenyl)-2,4-dihydroxy-N'-methylbenzenecarboximidamide |
| SMILES | C=C(N)N/C(=N\C)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H13N3O2/c1-6(11)13-10(12-2)8-4-3-7(14)5-9(8)15/h3-5,14-15H,1,11H2,2H3,(H,12,13) |
| InChIKey | BISBFHZLETYPPM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|